8-iso-13,14-dihydro-15-keto-PGF2a
Modify Date: 2025-09-29 13:40:11
8-iso-13,14-dihydro-15-keto-PGF2a structure
|
Common Name | 8-iso-13,14-dihydro-15-keto-PGF2a | ||
|---|---|---|---|---|
| CAS Number | 191919-02-5 | Molecular Weight | 354.481 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 543.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.2±23.8 °C | |
Use of 8-iso-13,14-dihydro-15-keto-PGF2a8-iso-13,14-dihydro-15-keto Prostaglandin F2α (8-iso-13,14-dihydro-15-keto PGF2α) is a metabolite of the isoprostane, 8-isoprostane (8-iso PGF2α), in rabbits, monkeys and humans. |
| Name | 8-iso-13,14-dihydro-15-keto Prostaglandin F2.α. |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.0±40.0 °C at 760 mmHg |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.481 |
| Flash Point | 296.2±23.8 °C |
| Exact Mass | 354.240631 |
| PSA | 94.83000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | VKTIONYPMSCHQI-JPRPWBOBSA-N |
| SMILES | CCCCCC(=O)CCC1C(O)CC(O)C1CC=CCCCC(=O)O |
| (5Z,8b,9a,11a)-9,11-dihydroxy-15-oxo-Prost-5-en-1-oic acid |
| 8-iso-13,14-dihydro-15-keto-PGF2a |
| (5Z,8β,9α,11α)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid |
| Prost-5-en-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,8β,9α,11α)- |