11β-13,14-dihydro-15-keto Prostaglandin F2α structure
|
Common Name | 11β-13,14-dihydro-15-keto Prostaglandin F2α | ||
|---|---|---|---|---|
| CAS Number | 107615-77-0 | Molecular Weight | 354.481 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 543.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.2±23.8 °C | |
| Name | 11β-13,14-dihydro-15-keto Prostaglandin F2α |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.0±40.0 °C at 760 mmHg |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.481 |
| Flash Point | 296.2±23.8 °C |
| Exact Mass | 354.240631 |
| PSA | 94.83000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | VKTIONYPMSCHQI-KGILNJEGSA-N |
| SMILES | CCCCCC(=O)CCC1C(O)CC(O)C1CC=CCCCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Prost-5-en-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,9α,11β)- |
| 13,14-Dihydro-15-keto-PGD2 |
| 13,14-Dihydro-15-ketoprostadlandin D2 |
| 13,14-dihydro-15-keto-16,16-difluoro-Prostaglandin E1 |
| 9ALPHA-HYDROXY-11,15-DIOXO-PROST-5Z-EN-1-OIC ACID |
| 13,14-dihydro-15-keto Prostaglandin D2 Lipid Maps MS Standard |
| DK-PGD2 |
| 13,14-dihydro-15-keto PD2 |
| 13,14-dihydro-15-keto-prostaglandin D2 |
| 13,14-dihydro-15-keto-16,16-difluoro-PGE1 |
| (5Z,9α,11β)-9,11-Dihydroxy-15-oxoprost-5-en-1-oic acid |