5-Me-dC(Ac) amidite structure
|
Common Name | 5-Me-dC(Ac) amidite | ||
|---|---|---|---|---|
| CAS Number | 1873306-74-1 | Molecular Weight | 785.865 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H52N5O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Me-dC(Ac) amidite5-Me-dC(Ac) amidite is used for synthesizing DNA or RNA[1]. |
| Name | 5'-DMT-N4-Ac-5-Me-dC Phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Me-dC(Ac) amidite is used for synthesizing DNA or RNA[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Turner J. Spermine Phosphoramidite: A potent modification with many applications. |
| Molecular Formula | C42H52N5O8P |
|---|---|
| Molecular Weight | 785.865 |
| Exact Mass | 785.355347 |
| LogP | 8.32 |
| InChIKey | YFUQEQDYBKCNTE-CMFYRTQUSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(NC(C)=O)nc3=O)CC2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | 2-8℃ |
| MFCD11114390 |
| DMT-5-Methyl-dC(ac) Phosphoramidite |
| Cytidine, N-acetyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]-2'-deoxy-5-methyl- |
| N4-Acetyl-5'-O-DMT-2'-O-methyl-5-methylcytidine 3'-CE phosphoramidite |
| 5-Methyl-dC(ac) amidite |