5-(2,5-DICHLOROPHENYL)-2-FUROIC ACID structure
|
Common Name | 5-(2,5-DICHLOROPHENYL)-2-FUROIC ACID | ||
|---|---|---|---|---|
| CAS Number | 186830-98-8 | Molecular Weight | 257.07000 | |
| Density | 1.477g/cm3 | Boiling Point | 402.3ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2O3 | Melting Point | 233-237ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(2,5-dichlorophenyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760 mmHg |
| Melting Point | 233-237ºC(lit.) |
| Molecular Formula | C11H6Cl2O3 |
| Molecular Weight | 257.07000 |
| Flash Point | 197.1ºC |
| Exact Mass | 255.96900 |
| PSA | 50.44000 |
| LogP | 3.95160 |
| Vapour Pressure | 3.4E-07mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | ATAZLMGGQQLRBC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
|
~57%
5-(2,5-DICHLORO... CAS#:186830-98-8 |
| Literature: Gorak; Obushak; Matiichuk; Lytvyn Russian Journal of Organic Chemistry, 2009 , vol. 45, # 4 p. 541 - 550 |
|
~%
5-(2,5-DICHLORO... CAS#:186830-98-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 12 p. 3258 - 3261 |
|
~%
5-(2,5-DICHLORO... CAS#:186830-98-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 12 p. 3258 - 3261 |
|
~%
5-(2,5-DICHLORO... CAS#:186830-98-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 12 p. 3258 - 3261 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2evm |
| MFCD02213561 |
| FC2 |