2,3-Dihydroxypterodontic acid structure
|
Common Name | 2,3-Dihydroxypterodontic acid | ||
|---|---|---|---|---|
| CAS Number | 185821-32-3 | Molecular Weight | 266.333 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2±25.2 °C | |
Use of 2,3-Dihydroxypterodontic acid2α,3β-Dihydroxypterodontic acid is a natural product used for synthesize 2α,3β-dihydroxy-5,11(13)-dien-eudesman-12-oic acid[1]. |
| Name | 2-[(2R,4aS,6R,7R,8R)-6,7-Dihydroxy-4a,8-dimethyl-2,3,4,4a,5,6,7,8 -octahydro-2-naphthalenyl]acrylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2α,3β-Dihydroxypterodontic acid is a natural product used for synthesize 2α,3β-dihydroxy-5,11(13)-dien-eudesman-12-oic acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.3±45.0 °C at 760 mmHg |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.333 |
| Flash Point | 237.2±25.2 °C |
| Exact Mass | 266.151794 |
| PSA | 77.76000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | MNLUMTSGGLOUCH-PPTFASHNSA-N |
| SMILES | C=C(C(=O)O)C1C=C2C(C)C(O)C(O)CC2(C)CC1 |
| Hazard Codes | Xi |
|---|
| 2-[(2R,4aS,6R,7R,8R)-6,7-Dihydroxy-4a,8-dimethyl-2,3,4,4a,5,6,7,8-octahydro-2-naphthalenyl]acrylic acid |
| 2-Naphthaleneacetic acid, 2,3,4,4a,5,6,7,8-octahydro-6,7-dihydroxy-4a,8-dimethyl-α-methylene-, (2R,4aS,6R,7R,8R)- |