N-octyl-D-gluconamide
Modify Date: 2025-08-22 09:28:41
N-octyl-D-gluconamide structure
|
Common Name | N-octyl-D-gluconamide | ||
|---|---|---|---|---|
| CAS Number | 18375-61-6 | Molecular Weight | 307.38300 | |
| Density | 1.207g/cm3 | Boiling Point | 631.5ºC at 760mmHg | |
| Molecular Formula | C14H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.7ºC | |
| Name | N-octyl-D-gluconamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 631.5ºC at 760mmHg |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.38300 |
| Flash Point | 335.7ºC |
| Exact Mass | 307.19900 |
| PSA | 130.25000 |
| Vapour Pressure | 1.34E-18mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | KTMBZDQOFPBYBL-FVCCEPFGSA-N |
| SMILES | CCCCCCCCNC(=O)C(O)C(O)C(O)C(O)CO |
| HS Code | 2924199090 |
|---|
|
~%
N-octyl-D-gluco... CAS#:18375-61-6 |
| Literature: Svenson, Soenke; Koenig, Juergen; Fuhrhop, Juergen-Hinrich Journal of Physical Chemistry, 1994 , vol. 98, # 3 p. 1022 - 1028 |
|
~%
N-octyl-D-gluco... CAS#:18375-61-6 |
| Literature: Baeyens-Volant, D.; Fornasier, R.; Szalai, E.; David, C. Molecular Crystals and Liquid Crystals (1969-1991), 1986 , vol. 135, p. 93 - 110 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Caprylylcarbazole |
| N-Octylcarbazole |
| 9-OCTYL-9H-CARBAZOLE |
| 9H-Carbazole,9-octyl |
| 9-n-Octylcarbazole |
| N-octyl-9H-carbazole |
| N-n-octylcarbazole |