N-hexyl-D-gluconamide structure
|
Common Name | N-hexyl-D-gluconamide | ||
|---|---|---|---|---|
| CAS Number | 18375-59-2 | Molecular Weight | 279.33000 | |
| Density | 1.26g/cm3 | Boiling Point | 629.1ºC at 760mmHg | |
| Molecular Formula | C12H25NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.3ºC | |
| Name | N-hexyl-D-gluconamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 629.1ºC at 760mmHg |
| Molecular Formula | C12H25NO6 |
| Molecular Weight | 279.33000 |
| Flash Point | 334.3ºC |
| Exact Mass | 279.16800 |
| PSA | 130.25000 |
| Vapour Pressure | 1.82E-18mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | WMZPVFOBKVXTGO-CHWFTXMASA-N |
| SMILES | CCCCCCNC(=O)C(O)C(O)C(O)C(O)CO |
| HS Code | 2924199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D-Gluconamido-n-hexan |
| Einecs 242-253-1 |