N-Octylglucamine structure
|
Common Name | N-Octylglucamine | ||
|---|---|---|---|---|
| CAS Number | 23323-37-7 | Molecular Weight | 293.400 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 524.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H31NO5 | Melting Point | 121-124 °C(lit.) | |
| MSDS | N/A | Flash Point | 164.7±20.7 °C | |
| Name | (2R,3R,4R,5S)-6-(octylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.7±50.0 °C at 760 mmHg |
| Melting Point | 121-124 °C(lit.) |
| Molecular Formula | C14H31NO5 |
| Molecular Weight | 293.400 |
| Flash Point | 164.7±20.7 °C |
| Exact Mass | 293.220215 |
| PSA | 113.18000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | ZRRNJJURLBXWLL-REWJHTLYSA-N |
| SMILES | CCCCCCCCNCC(O)C(O)C(O)C(O)CO |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-n-Octyl-D-glucamine |
| N-Octylglucamine |
| EINECS 245-582-9 |
| (2R,3R,4R,5S)-6-(Octylamino)hexane-1,2,3,4,5-pentaol |
| (2R,3R,4R,5S)-6-(Octylamino)-1,2,3,4,5-hexanepentol |
| D-Glucitol, 1-deoxy-1-(octylamino)- |
| N-Octyl-D-glucamine |
| N-Octyl-D-glucosamine |
| 1-Deoxy-1-(octylamino)-D-glucitol |
| 1-Deoxy-1-(n-Octylamino)-D-Glucitol |
| MFCD00134352 |