t-Butoxycarbonyl-PEG4-sulfonic acid
Modify Date: 2025-08-27 08:10:17
t-Butoxycarbonyl-PEG4-sulfonic acid structure
|
Common Name | t-Butoxycarbonyl-PEG4-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 1817735-26-4 | Molecular Weight | 386.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of t-Butoxycarbonyl-PEG4-sulfonic acidBoc-PEG4-sulfonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Boc-PEG4-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-PEG4-sulfonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H30O9S |
|---|---|
| Molecular Weight | 386.46 |
| InChIKey | YPGODLLTTUNMNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCS(=O)(=O)O |
| MFCD29042372 |