SY-1365 structure
|
Common Name | SY-1365 | ||
|---|---|---|---|---|
| CAS Number | 1816989-16-8 | Molecular Weight | 587.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35ClN8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SY-1365SY-1365 is a highly selective covalent inhibitor of CDK7. SY-1365 possesses therapeutic potential in both hematological and solid tumors[1]. |
| Name | SY-1365 |
|---|
| Description | SY-1365 is a highly selective covalent inhibitor of CDK7. SY-1365 possesses therapeutic potential in both hematological and solid tumors[1]. |
|---|---|
| Related Catalog | |
| Target |
CDK7 |
| References |
| Molecular Formula | C31H35ClN8O2 |
|---|---|
| Molecular Weight | 587.12 |
| InChIKey | SCJNYBYSTCRPAO-LXBQGUBHSA-N |
| SMILES | CN(C)CC=CC(=O)Nc1ccc(C(=O)NC2(C)CCCC(Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)nc1 |