Hydroxy-PEG3-PFP ester structure
|
Common Name | Hydroxy-PEG3-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1807537-40-1 | Molecular Weight | 388.284 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H17F5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1±28.7 °C | |
Use of Hydroxy-PEG3-PFP esterHydroxy-PEG3-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Hydroxy-PEG3-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG3-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.3±45.0 °C at 760 mmHg |
| Molecular Formula | C15H17F5O6 |
| Molecular Weight | 388.284 |
| Flash Point | 220.1±28.7 °C |
| Exact Mass | 388.094543 |
| LogP | 1.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | MDIKFXKPNIRFLO-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCO)Oc1c(F)c(F)c(F)c(F)c1F |
| Propanoic acid, 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester |
| MFCD26793756 |
| Pentafluorophenyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate |