m-PEG5-phosphonic acid
Modify Date: 2025-08-27 11:10:08
m-PEG5-phosphonic acid structure
|
Common Name | m-PEG5-phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 1807512-39-5 | Molecular Weight | 316.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H25O8P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG5-phosphonic acidm-PEG5-phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | m-PEG5-phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG5-phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C11H25O8P |
|---|---|
| Molecular Weight | 316.29 |
| InChIKey | RCTDZLSRRJVKHJ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCP(=O)(O)O |
| MFCD28505503 |