Cefuroxime-d3 structure
|
Common Name | Cefuroxime-d3 | ||
|---|---|---|---|---|
| CAS Number | 1803240-98-3 | Molecular Weight | 427.40 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13D3N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cefuroxime-d3Cefuroxime-d3 is deuterium labeled Cefuroxime (sodium). Cefuroxime sodium is an orally active second-generation cephalosporin antibiotic with increased stability to β-lactamase. Cefuroxime sodium has a broad spectrum activity against Gram-positive and Gram-negative bacteria[1]. |
| Name | Cefuroxime-d3 |
|---|---|
| Synonym | More Synonyms |
| Description | Cefuroxime-d3 is deuterium labeled Cefuroxime (sodium). Cefuroxime sodium is an orally active second-generation cephalosporin antibiotic with increased stability to β-lactamase. Cefuroxime sodium has a broad spectrum activity against Gram-positive and Gram-negative bacteria[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H13D3N4O8S |
| Molecular Weight | 427.40 |
| Exact Mass | 427.087708 |
| LogP | 0.47 |
| Index of Refraction | 1.735 |
| InChIKey | JFPVXVDWJQMJEE-QDGUUNGESA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(COC(N)=O)CSC12)c1ccco1 |
| 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 3-[[(aminocarbonyl)oxy]methyl]-7-[[(2Z)-2-(2-furanyl)-2-[(methyl-d3-oxy)imino]-1-oxoethyl]amino]-8-oxo-, (6R,7R)- |
| Cefuroxime-d3 |
| (6R,7R)-3-[(Carbamoyloxy)methyl]-7-{[(2Z)-2-(2-furyl)-2-{[(2H3)methyloxy]imino}acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |