Dde Biotin-PEG4-alkyne
Modify Date: 2025-08-25 15:35:34
Dde Biotin-PEG4-alkyne structure
|
Common Name | Dde Biotin-PEG4-alkyne | ||
|---|---|---|---|---|
| CAS Number | 1802908-00-4 | Molecular Weight | 650.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H50N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dde Biotin-PEG4-alkyneDde Biotin-PEG4-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Dde Biotin-PEG4-Alkyne |
|---|
| Description | Dde Biotin-PEG4-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C32H50N4O8S |
|---|---|
| Molecular Weight | 650.83 |
| InChIKey | BDJHEZRAKBBIJH-UCVANPEUSA-N |
| SMILES | C#CCN=C(CCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21)C1=C(O)CC(C)(C)CC1=O |