Methyltetrazine-PEG5-alkyne
Modify Date: 2025-08-26 20:41:38
Methyltetrazine-PEG5-alkyne structure
|
Common Name | Methyltetrazine-PEG5-alkyne | ||
|---|---|---|---|---|
| CAS Number | 1802907-97-6 | Molecular Weight | 402.444 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 568.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5±23.1 °C | |
Use of Methyltetrazine-PEG5-alkyneMethyltetrazine-PEG5-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Methyltetrazine-PEG5-Alkyne |
|---|---|
| Synonym | More Synonyms |
| Description | Methyltetrazine-PEG5-alkyne is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.5±60.0 °C at 760 mmHg |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.444 |
| Flash Point | 198.5±23.1 °C |
| Exact Mass | 402.190308 |
| LogP | 0.04 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | OAKPIEOTVXLRCN-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOc1ccc(-c2nnc(C)nn2)cc1 |
| 1,2,4,5-Tetrazine, 3-methyl-6-[4-(3,6,9,12-tetraoxapentadec-14-yn-1-yloxy)phenyl]- |
| 3-Methyl-6-[4-(3,6,9,12-tetraoxapentadec-14-yn-1-yloxy)phenyl]-1,2,4,5-tetrazine |
| MFCD28334550 |