MegastigM-7-ene-3,4,6,9-tetrol structure
|
Common Name | MegastigM-7-ene-3,4,6,9-tetrol | ||
|---|---|---|---|---|
| CAS Number | 180164-14-1 | Molecular Weight | 244.327 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 371.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9±22.5 °C | |
Use of MegastigM-7-ene-3,4,6,9-tetrolMegastigm-7-ene-3,4,6,9-tetrol is a natural product that can be isolated from Apollonias barbujana[1]. |
| Name | (4-Amino-3-fluorophenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Megastigm-7-ene-3,4,6,9-tetrol is a natural product that can be isolated from Apollonias barbujana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.6±42.0 °C at 760 mmHg |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.327 |
| Flash Point | 171.9±22.5 °C |
| Exact Mass | 244.167465 |
| PSA | 80.92000 |
| LogP | 0.84 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | GOTQJVUEKCNRKB-BUIQRULISA-N |
| SMILES | CC(O)C=CC1(O)C(C)C(O)C(O)CC1(C)C |
| Hazard Codes | Xi |
|---|
| 1,2,4-Cyclohexanetriol, 4-[(1E)-3-hydroxy-1-buten-1-yl]-3,5,5-trimethyl-, (1S,2S,3R,4R)- |
| (1S,2S,3R,4R)-4-[(1E)-3-Hydroxy-1-buten-1-yl]-3,5,5-trimethyl-1,2,4-cyclohexanetriol |