trimethyl(2-trimethylsilylprop-2-enyl)silane structure
|
Common Name | trimethyl(2-trimethylsilylprop-2-enyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17891-65-5 | Molecular Weight | 186.44200 | |
| Density | 0.779 g/mL at 25ºC(lit.) | Boiling Point | 63ºC30 mm Hg(lit.) | |
| Molecular Formula | C9H22Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99 °F | |
| Name | trimethyl(2-trimethylsilylprop-2-enyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.779 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 63ºC30 mm Hg(lit.) |
| Molecular Formula | C9H22Si2 |
| Molecular Weight | 186.44200 |
| Flash Point | 99 °F |
| Exact Mass | 186.12600 |
| LogP | 3.75820 |
| Index of Refraction | n20/D 1.439(lit.) |
| InChIKey | UNGXKSVOMSCMCE-UHFFFAOYSA-N |
| SMILES | C=C(C[Si](C)(C)C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,3-bis-trimethylsilanyl-propene |
| CH2C(SiMe3)CH2SiMe3 |
| 2,3-bis(trimethylsilyl)propene |
| Trimethyl<2-(trimethylsilyl)allyl>silan |
| <2-(Trimethylsilyl)allyl>-trimethylsilan |
| MFCD00216611 |
| 2,3-Bis(trimethylsilyl)-1-propene |
| 1-Propene,1,3-bis-trimethylsilyl |
| 2,3-Bis-trimethylsilyl-propen |
| 2,3-bis(trimethylsilyl)prop-1-ene |