Azide-PEG3-Tos
Modify Date: 2025-08-25 19:55:58
Azide-PEG3-Tos structure
|
Common Name | Azide-PEG3-Tos | ||
|---|---|---|---|---|
| CAS Number | 178685-33-1 | Molecular Weight | 329.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azide-PEG3-TosAzide-PEG3-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG3-Tos is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. |
| Name | 8-azido-3,6-dioxaoctyl tosylate |
|---|---|
| Synonym | More Synonyms |
| Description | Azide-PEG3-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG3-Tos is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Non-cleavable |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[2]. |
| References |
| Molecular Formula | C13H19N3O5S |
|---|---|
| Molecular Weight | 329.37200 |
| Exact Mass | 329.10500 |
| PSA | 119.96000 |
| LogP | 2.57736 |
| InChIKey | PTOJCKLTCKYNFG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCN=[N+]=[N-])cc1 |
| 2-(2-(2-azidoethoxy)ethoxy)ethyl toluenesulfonate |
| toluene 4-sulfonic acid 2-[2-(2-azidoethoxy)ethoxy] ethyl ester |
| 2-[2-(2-azidoethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| 2-(2-(2-azidoethoxy)ethoxy)ethyl tosylate |
| α-azidodeoxy-ω-O-tosyltriethyleneglycol |
| 2-(2-(2-azidoethoxy)ethoxy)ethyl 4-methylbenzenesulfonate |
| Toluene-4-sulfonic acid 2-[2-(2-azido-ethoxy)-ethoxy]-ethyl ester |