(4-Carboxybutyl)triphenylphosphonium bromide structure
|
Common Name | (4-Carboxybutyl)triphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 17814-85-6 | Molecular Weight | 443.313 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24BrO2P | Melting Point | 204-207 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-carboxybutyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 204-207 °C(lit.) |
|---|---|
| Molecular Formula | C23H24BrO2P |
| Molecular Weight | 443.313 |
| Exact Mass | 442.069733 |
| PSA | 50.89000 |
| LogP | 1.23940 |
| InChIKey | MLOSJPZSZWUDSK-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3278 |
| WGK Germany | 3 |
| HS Code | 29310095 |
(4-Carboxybutyl... CAS#:17814-85-6 ~%
(4-Carboxybutyl... CAS#:17814-85-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1847 - 1854 |
|
~%
(4-Carboxybutyl... CAS#:17814-85-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1847 - 1854 |
|
~%
(4-Carboxybutyl... CAS#:17814-85-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1847 - 1854 |
|
~%
(4-Carboxybutyl... CAS#:17814-85-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1847 - 1854 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(Carboxybutyl)triphenylphosphonium Bromide |
| (4-Carboxybutyl)(triphenyl)phosphonium bromide |
| Ph3P(1+)(CH2)4COOH*Br(1-) |
| 5-(Triphenylphosphonio)pentanoic acid bromide,Carboxybutyltriphenylphosphonium bromide |
| Ph3P(+)Br(-)(CH2)4CO2H |
| (4-carboxybutyl)triphenylphosphanium bromide |
| 4-carboxy-n-butyltriphenylphosphonium bromide |
| Phosphonium, (4-carboxybutyl)triphenyl-, bromide |
| (5-hydroxy-5-oxopentyl)-triphenylphosphanium bromide |
| EINECS 241-782-5 |
| MFCD00011906 |
| 4-hydroxycarbonylbutyltriphenylphosphonium bromide |
| Phosphonium, (4-carboxybutyl)triphenyl-, bromide (1:1) |
| BrPh3PCH2(CH2)3COOH |
| Phosphonium,(4-carboxybutyl)triphenyl-,bromide |
| triphenyl-(4-carboxybutyl)-phosphoniumbromide |
| (4-Carboxybutyl)Triphenylphosphonium Bromide |