Butyltriphenylphosphonium bromide structure
|
Common Name | Butyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 1779-51-7 | Molecular Weight | 399.304 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24BrP | Melting Point | 240-243 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | butyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 240-243 °C(lit.) |
|---|---|
| Molecular Formula | C22H24BrP |
| Molecular Weight | 399.304 |
| Exact Mass | 398.079895 |
| PSA | 13.59000 |
| LogP | 1.78460 |
| InChIKey | IKWKJIWDLVYZIY-UHFFFAOYSA-M |
| SMILES | CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R21/22;R36/37/38 |
| Safety Phrases | S36/37-S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | TA1855200 |
| HS Code | 2931900090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Estimation with an ion-selective electrode of the membrane potential in cells of Paracoccus denitrificans from the uptake of the butyltriphenylphosphonium cation during aerobic and anaerobic respiration.
Biochem. J. 196(1) , 311-21, (1981) 1. Aerobic respiration by cells of Paracoccus dentrificans drives the uptake of the lipophilic cation butyltriphenylphosphonium. Anaerobiosis or addition of an uncoupler of oxidative phosphorylation (... |
|
|
The measurement of membrane potential during photosynthesis and during respiration in intact cells of Rhodopseudomonas capsulata by both electrochromism and by permeant ion redistribution.
Biochem. J. 200(2) , 389-97, (1981) 1. The membrane potential in intact cells of Rhodopseudomonas capsulata during photosynthesis and during dark respiration has been measured by two independent methods. 2. The light-induced and O2-indu... |
|
|
Tandem mass spectrometric characterization of thiol peptides modified by the chemoselective cationic sulfhydryl reagent (4-iodobutyl)triphenylphosphonium--effects of a cationic thiol derivatization on peptide fragmentation.
J. Am. Soc. Mass Spectrom. 22(10) , 1771-83, (2011) Fixed charge chemical modifications on peptides and proteins can impact fragmentation behaviors in tandem mass spectrometry (MS/MS). In this study, we employed a thiol-specific cationic alkylation rea... |
| n-Butyltriphenylphosphonium chloride |
| N-Butyltriphenylphosphonium bromide |
| Butyl triphenyl phosphonium bromide |
| (1-Butyl)Triphenylphosphonium Bromide |
| n-C4H9PPh3Br |
| butyl(triphenyl)phosphoniumbromid |
| Butyltriphenylphosphonium bromide (TBP) |
| Phosphonium,butyltriphenyl-,bromide |
| MFCD00011855 |
| Ph3P(CH2)3CH3Br |
| (BUTYL)TRIPHENYLPHOSPHONIUM BROMIDE |
| Phosphonium, butyltriphenyl-, bromide (1:1) |
| Ph3P(+)CH2CH2CH2CH3Br(-) |
| butyl triphenyl phosphine bromide |
| Butyltriphenylphosphonium bromide |
| Butyl(triphenyl)phosphonium bromide |
| EINECS 217-219-4 |
| Butyl triphenylphosphonium bromide |