1,3-Dichloro-2-methoxy-5-nitrobenzene structure
|
Common Name | 1,3-Dichloro-2-methoxy-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 17742-69-7 | Molecular Weight | 222.025 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 305.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5Cl2NO3 | Melting Point | 97-100 °C | |
| MSDS | N/A | Flash Point | 138.6±26.5 °C | |
| Name | 1,3-dichloro-2-methoxy-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.6±37.0 °C at 760 mmHg |
| Melting Point | 97-100 °C |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.025 |
| Flash Point | 138.6±26.5 °C |
| Exact Mass | 220.964645 |
| PSA | 55.05000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | GJYVJKPFYCKNEC-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| Hazard Codes | N: Dangerous for the environment;T: Toxic; |
|---|---|
| Risk Phrases | R51/53 |
| Safety Phrases | S61-S45-S36/37 |
| HS Code | 2909309090 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-Dichlor-4-nitro-anisol |
| Methyl-(2.6-dichlor-4-nitro-phenyl)-aether |
| 2.6-Dichlor-4-nitro-1-methoxy-benzol |
| 2,6-Dichloro-4-nitrophenyl methyl ether |
| 2,6-Dichloro-4-nitroanisole |
| Benzene, 1,3-dichloro-2-methoxy-5-nitro- |
| 1,3-Dichloro-2-methoxy-5-nitrobenzene |
| EINECS 403-350-6 |
| 3,5-dichloro-4-methoxynitrobenzene |
| MFCD00061129 |