1,3-Dichloro-2-methoxy-5-nitrobenzene structure
|
Common Name | 1,3-Dichloro-2-methoxy-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 37138-82-2 | Molecular Weight | 222.025 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 305.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6±26.5 °C | |
| Name | 1,5-dichloro-2-methoxy-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.6±37.0 °C at 760 mmHg |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.025 |
| Flash Point | 138.6±26.5 °C |
| Exact Mass | 220.964645 |
| PSA | 55.05000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | OQRXLBNJKPMELG-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-dichloro-6-nitroanisole |
| 2,4-dicloro-6-nitroanisole |
| 2,6-Dichloro-4-nitrophenyl methyl ether |
| Benzene, 1,3-dichloro-2-methoxy-5-nitro- |
| 1,3-Dichloro-2-methoxy-5-nitrobenzene |
| 2,4-Dichlor-6-nitro-anisol |
| 4,6-Dichloro-2-nitrophenol-methylaether |
| Benzene,1,5-dichloro-2-methoxy-3-nitro |
| 2,4,5-TRIFLUOROBENZESULFONAMIDE |