R 568 hydrochloride structure
|
Common Name | R 568 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 177172-49-5 | Molecular Weight | 340.28700 | |
| Density | N/A | Boiling Point | 416.3ºC at 760 mmHg | |
| Molecular Formula | C18H23Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
Use of R 568 hydrochlorideTecalcet Hydrochloride (R 568 Hydrochloride), an orally active calcimimetic compound, allosterically and positively modulates the calcium-sensing receptor (CaSR). Tecalcet Hydrochloride (R 568 Hydrochloride) increases the sensitivity to activation by extracellular Ca2+[1][2][3]. |
| Name | 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Tecalcet Hydrochloride (R 568 Hydrochloride), an orally active calcimimetic compound, allosterically and positively modulates the calcium-sensing receptor (CaSR). Tecalcet Hydrochloride (R 568 Hydrochloride) increases the sensitivity to activation by extracellular Ca2+[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 416.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H23Cl2NO |
| Molecular Weight | 340.28700 |
| Flash Point | 205.6ºC |
| Exact Mass | 339.11600 |
| PSA | 21.26000 |
| LogP | 5.82490 |
| Vapour Pressure | 3.86E-07mmHg at 25°C |
| InChIKey | YJXUXANREVNZLH-PFEQFJNWSA-N |
| SMILES | COc1cccc(C(C)NCCCc2ccccc2Cl)c1.Cl |
| Norcalcin |
| R-568 |
| Tecalcet hydrochloride |
| KRN-568 |
| NPS R-568 |
| Tecalcet HCl |