Diphenylacetic Anhydride structure
|
Common Name | Diphenylacetic Anhydride | ||
|---|---|---|---|---|
| CAS Number | 1760-46-9 | Molecular Weight | 406.47200 | |
| Density | 1.18g/cm3 | Boiling Point | 556.7ºC at 760mmHg | |
| Molecular Formula | C28H22O3 | Melting Point | 98 °C | |
| MSDS | N/A | Flash Point | 268.4ºC | |
| Name | Diphenylacetic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 556.7ºC at 760mmHg |
| Melting Point | 98 °C |
| Molecular Formula | C28H22O3 |
| Molecular Weight | 406.47200 |
| Flash Point | 268.4ºC |
| Exact Mass | 406.15700 |
| PSA | 43.37000 |
| LogP | 5.72040 |
| Vapour Pressure | 1.97E-12mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | YZMRCMTTYLBDPD-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2,2-diphenylacetyl) 2,2-diphenylacetate |
| DIPHENYLACETICANHYDRIDE |