1,4,7-tri-Boc-1,4,7,10-Tetraazacyclododecane structure
|
Common Name | 1,4,7-tri-Boc-1,4,7,10-Tetraazacyclododecane | ||
|---|---|---|---|---|
| CAS Number | 175854-39-4 | Molecular Weight | 472.619 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 542.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C23H44N4O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 282.1±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tri-tert-Butyl 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.8±35.0 °C at 760 mmHg |
| Molecular Formula | C23H44N4O6 |
| Molecular Weight | 472.619 |
| Flash Point | 282.1±25.9 °C |
| Exact Mass | 472.326080 |
| PSA | 100.65000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | ZXASHTYJQJMCQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Kimura, E., et al.
J. Am. Chem. Soc. 119 , 3068, (1997)
|
| Tris(2-methyl-2-propanyl) 1,4,7,10-tetraazacyclododecane-1,4,7-tricarboxylate |
| N,N',N''-Tri-Boc-cyclen |
| MFCD09953471 |
| tritert-butyl 1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| 1,4,7,10-Tetraazacyclododecane-1,4,7-tricarboxylic acid, tris(1,1-dimethylethyl) ester |