1,4,7,10-Tetrakis(ethoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane structure
|
Common Name | 1,4,7,10-Tetrakis(ethoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane | ||
|---|---|---|---|---|
| CAS Number | 137076-50-7 | Molecular Weight | 516.62800 | |
| Density | 1.091g/cm3 | Boiling Point | 569.7ºC at 760 mmHg | |
| Molecular Formula | C24H44N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.3ºC | |
| Name | 1,4,7,10-Tetrakis(ethoxycarbonylmethyl)-1,4,7,10-tetraazacyclododecane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 569.7ºC at 760 mmHg |
| Molecular Formula | C24H44N4O8 |
| Molecular Weight | 516.62800 |
| Flash Point | 298.3ºC |
| Exact Mass | 516.31600 |
| PSA | 118.16000 |
| Vapour Pressure | 5.45E-13mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | SHXTUKRRXWXLMI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)CCN(CC(=O)OCC)CCN(CC(=O)OCC)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 2-[4,7,10-tris(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| MFCD09263313 |