3,3',5,5'-tetrakis(trifluoromethyl)benzophenone structure
|
Common Name | 3,3',5,5'-tetrakis(trifluoromethyl)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 175136-66-0 | Molecular Weight | 454.21000 | |
| Density | 1.506g/cm3 | Boiling Point | 325.2ºC at 760 mmHg | |
| Molecular Formula | C17H6F12O | Melting Point | 139-140°C | |
| MSDS | N/A | Flash Point | 124.7ºC | |
| Name | bis[3,5-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 325.2ºC at 760 mmHg |
| Melting Point | 139-140°C |
| Molecular Formula | C17H6F12O |
| Molecular Weight | 454.21000 |
| Flash Point | 124.7ºC |
| Exact Mass | 454.02300 |
| PSA | 17.07000 |
| LogP | 6.99280 |
| Vapour Pressure | 0.000233mmHg at 25°C |
| Index of Refraction | 1.417 |
| InChIKey | GATWMPGNBWPCIY-UHFFFAOYSA-N |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| 3,3',5,5'-Tetrakis(trifluoromethyl)benzophenone |
| MFCD00042474 |
| HMS549N11 |