Pyraclostrobine
Modify Date: 2025-08-20 16:24:24
Pyraclostrobine structure
|
Common Name | Pyraclostrobine | ||
|---|---|---|---|---|
| CAS Number | 175013-18-0 | Molecular Weight | 387.817 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 501.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H18ClN3O4 | Melting Point | 63.7-65.2° | |
| MSDS | Chinese USA | Flash Point | 256.8±32.9 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of PyraclostrobinePyraclostrobin is a strobilurin fungicide that inhibits mitochondrial complex III of fungal and mammalian cells. Pyraclostrobin induces triglyceride accumulation and triglyceride accumulation in 3T3-L1 cells. |
| Name | Pyraclostrobin |
|---|---|
| Synonym | More Synonyms |
| Description | Pyraclostrobin is a strobilurin fungicide that inhibits mitochondrial complex III of fungal and mammalian cells. Pyraclostrobin induces triglyceride accumulation and triglyceride accumulation in 3T3-L1 cells. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.1±60.0 °C at 760 mmHg |
| Melting Point | 63.7-65.2° |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.817 |
| Flash Point | 256.8±32.9 °C |
| Exact Mass | 387.098572 |
| PSA | 65.82000 |
| LogP | 4.25 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | HZRSNVGNWUDEFX-UHFFFAOYSA-N |
| SMILES | COC(=O)N(OC)c1ccccc1COc1ccn(-c2ccc(Cl)cc2)n1 |
| Storage condition | 0-6°C |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H331-H410 |
| Precautionary Statements | P261-P273-P304 + P340 + P312-P391-P403 + P233-P501 |
| Personal Protective Equipment | Gloves |
| Hazard Codes | N |
| Risk Phrases | 50/53 |
| Safety Phrases | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2.0 |
| RTECS | EZ3441000 |
| Hazard Class | 9.0 |
CAS#:76205-19-1
CAS#:106-39-8
CAS#:3958-60-9![Pyrrolidine, 1-[ (2-nitrophenyl)methyl]- Structure](https://image.chemsrc.com/caspic/435/55581-63-0.png)
CAS#:55581-63-0
CAS#:1334322-42-7
CAS#:1334322-44-9|
Off-line coupling of multidimensional immunoaffinity chromatography and ion mobility spectrometry: A promising partnership.
J. Chromatogr. A. 1426 , 110-7, (2015) The extreme specificity of immunoaffinity chromatography (IAC) columns coupled to the high sensitivity of ion mobility spectrometry (IMS) measurements makes this combination really useful for rapid, s... |
| Carbamic acid, N-[2-[[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]-N-methoxy-, methyl ester |
| methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-methoxycarbamate |
| methyl 2-[1-(4-chlorophenyl)pyrazol-3-yloxymethyl]-N-methoxycarbanilate |
| carbamic acid, [2-[[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]methoxy-, methyl ester |
| Pyraclostrobine |
| Methyl (2-(((1-(4-chlorophenyl)-1H-pyrazol-3-yl)oxy)methyl)phenyl)(methoxy)carbamate |
| Pyraclostrobin |
| methyl N-[2-[[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]phenyl]-N-methoxycarbamate |
| Methyl [2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)phenyl]methoxycarbamate |