4-Methyl-3-nitroanisole structure
|
Common Name | 4-Methyl-3-nitroanisole | ||
|---|---|---|---|---|
| CAS Number | 17484-36-5 | Molecular Weight | 167.162 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 269.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 17 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 127.2±23.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Methyl-3-nitroanisole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 269.4±20.0 °C at 760 mmHg |
| Melting Point | 17 °C(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 127.2±23.8 °C |
| Exact Mass | 167.058243 |
| PSA | 55.05000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | JBORNNNGTJSTLC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)c([N+](=O)[O-])c1 |
| Water Solubility | insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
A bait and switch hapten strategy generates catalytic antibodies for phosphodiester hydrolysis.
Proc. Natl. Acad. Sci. U. S. A. 95(11) , 5971-5, (1998) General base catalysis supplied by the histidine-12 (H-12) residue of ribonuclease (RNase) A has long been appreciated as a major component of the catalytic power of the enzyme. In an attempt to harne... |
|
|
Synthesis and evaluation of 5,7-dihydro-3-[2-[1-(4-[18F]-fluorobenzyl)-4-piperidinyl]ethyl]-6H-pyrrolo[3,2-f]-1,2-benzisoxazol-6-one for in vivo mapping of acetylcholinesterase.
Nucl. Med. Commun. 25(6) , 591-6, (2004) Acetylcholinesterase (AChE) is an important cholinergic marker for the diagnosis of Alzheimer's disease (AD). A recent study has demonstrated that C-labelled 5,7-dihydro-7-methyl-3-[2-[1-(phenylmethyl... |
| 4-Methyl-3-nitroanisole |
| Methyl 4-methyl-3-nitrophenyl ether |
| Benzene, 4-methoxy-1-methyl-2-nitro- |
| EINECS 241-500-0 |
| MFCD00007173 |
| 4-Methoxy-1-methyl-2-nitrobenzene |
| 4-Methoxy-2-nitrotoluene |