β-Tomatine structure
|
Common Name | β-Tomatine | ||
|---|---|---|---|---|
| CAS Number | 17406-46-1 | Molecular Weight | 902.07300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H75NO17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of β-Tomatineβ-Tomatine is a breakdown product of a-tomatine and a less fungitoxic compound. β-Tomatine can suppress plant defense responses[1]. |
| Name | β1-tomatine |
|---|---|
| Synonym | More Synonyms |
| Description | β-Tomatine is a breakdown product of a-tomatine and a less fungitoxic compound. β-Tomatine can suppress plant defense responses[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C45H75NO17 |
|---|---|
| Molecular Weight | 902.07300 |
| Exact Mass | 901.50300 |
| PSA | 278.94000 |
| InChIKey | DMUPZSDWJVULSC-MMQVRIEESA-N |
| SMILES | CC1CCC2(NC1)OC1CC3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C(O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| Hazard Codes | Xi |
|---|
| β1-Tomatin |