Bevirimat structure
|
Common Name | Bevirimat | ||
|---|---|---|---|---|
| CAS Number | 174022-42-5 | Molecular Weight | 584.826 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 662.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C36H56O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7±20.8 °C | |
Use of BevirimatBevirimat(YK FH312; FH11327; MPC-4326) is an anti-HIV drug derived from a betulinic acid-like compound; is believed to inhibit HIV by a novel mechanism, so-called maturation inhibition.IC50 value:Target: Anti-HIVLike protease inhibitors, bevirimat and other maturation inhibitors interfere with protease processing of newly translated HIV polyprotein precursor, called gag. Bevirimat prevents this viral replication by specifically inhibiting cleavage of the capsid protein (CA) from the SP1 spacer protein. |
| Name | bevirimat |
|---|---|
| Synonym | More Synonyms |
| Description | Bevirimat(YK FH312; FH11327; MPC-4326) is an anti-HIV drug derived from a betulinic acid-like compound; is believed to inhibit HIV by a novel mechanism, so-called maturation inhibition.IC50 value:Target: Anti-HIVLike protease inhibitors, bevirimat and other maturation inhibitors interfere with protease processing of newly translated HIV polyprotein precursor, called gag. Bevirimat prevents this viral replication by specifically inhibiting cleavage of the capsid protein (CA) from the SP1 spacer protein. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 662.7±40.0 °C at 760 mmHg |
| Molecular Formula | C36H56O6 |
| Molecular Weight | 584.826 |
| Flash Point | 197.7±20.8 °C |
| Exact Mass | 584.407715 |
| PSA | 100.90000 |
| LogP | 10.15 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | YJEJKUQEXFSVCJ-WRFMNRASSA-N |
| SMILES | C=C(C)C1CCC2(C(=O)O)CCC3(C)C(CCC4C5(C)CCC(OC(=O)CC(C)(C)C(=O)O)C(C)(C)C5CCC43C)C12 |
| Storage condition | -20°C |
| DSB |
| UNII-S125DW66N8 |
| 3-O-(3',3'-dimethylsuccinyl)betulinic acid |
| YK FH312 |
| YK-FH312 |
| PA-457 |
| BVM |
| (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-(3-carboxy-3-methylbutanoyl)oxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid |
| Bevirimat |
| Butanedioic acid, 2,2-dimethyl-, 4-[(3β)-28-hydroxy-28-oxolup-20(29)-en-3-yl] ester |
| (3β)-3-[(3-Carboxy-3-methylbutanoyl)oxy]lup-20(29)-en-28-oic acid |