Slingshot inhibitor D3 structure
|
Common Name | Slingshot inhibitor D3 | ||
|---|---|---|---|---|
| CAS Number | 1715076-35-9 | Molecular Weight | 461.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H19NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Slingshot inhibitor D3Novel Potent Inhibitor of the Protein Phosphatase Slingshot |
| Name | Slingshot inhibitor D3 |
|---|
| Description | Novel Potent Inhibitor of the Protein Phosphatase Slingshot |
|---|
| Molecular Formula | C25H19NO4S2 |
|---|---|
| Molecular Weight | 461.55 |
| InChIKey | JZFBPGPPIJBVMI-HMAPJEAMSA-N |
| SMILES | Cc1ccccc1N1C(=O)C(=Cc2ccc(OCc3ccc(C(=O)O)cc3)cc2)SC1=S |