4-tert-Butylbenzoyl chloride structure
|
Common Name | 4-tert-Butylbenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1710-98-1 | Molecular Weight | 196.673 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 250.3±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H13ClO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 111.6±14.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-tert-Butylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 250.3±0.0 °C at 760 mmHg |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.673 |
| Flash Point | 111.6±14.6 °C |
| Exact Mass | 196.065491 |
| PSA | 17.07000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | WNLMYNASWOULQY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)Cl)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S24/25 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29163900 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
The "kinetic capture" of an acylium ion from live aluminum chloride promoted Friedel-Crafts acylation reactions.
Org. Biomol. Chem. 11(11) , 1810-4, (2013) AlCl(3) promoted Friedel-Crafts acylation between 4-tert-butylbenzoyl chloride and mesitylene was investigated. The donor-acceptor complex was observed as the major species. Kinetic investigation demo... |
|
|
Syntheses and spectroscopic studies of spirobifluorene-bridged bipolar systems; photoinduced electron transfer reactions.
Chem. Commun. (Camb.) (23) , 2874-5, (2002) Some 9,9'-spirobifluorene-bridged bipolar systems 1-3 containing 1,3,4-oxadiazole-conjugated oligoaryl and triarylamine moieties have been synthesized, in which 1 exhibits remarkable solvent-polarity ... |
|
|
Statistical copolymers with side-chain hole and electron transport groups for single-layer electroluminescent device applications. Jiang X, et al.
Chem. Mater. 12(9) , 2542-2549, (2000)
|
| Benzoyl chloride, 4-(1,1-dimethylethyl)- |
| 4-tert-butyl-benzoyl chloride |
| P-tert-butylbenzoyl chloride |
| Benzoyl chloride,4-(1,1-dimethylethyl) |
| p-tert-butyl-benzoyl chloride |
| EINECS 216-973-1 |
| 4-tert-Butylbenzoyl chloride |
| 4-t-BuC6H4COCl |
| 4-(1,1-dimethylethyl)benzoyl chloride |
| p-tert-Bu-C6H4COCl |
| 4-(2-Methyl-2-propanyl)benzoyl chloride |
| 4-(1,1-dimethylethyl)benzoic acid chloride |
| MFCD00000695 |
| Benzoyl chloride, p-tert-butyl- |