Chloridazon structure
|
Common Name | Chloridazon | ||
|---|---|---|---|---|
| CAS Number | 1698-60-8 | Molecular Weight | 221.643 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 312.2±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClN3O | Melting Point | 206ºC (tech., 198-202ºC) | |
| MSDS | Chinese USA | Flash Point | 142.6±30.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | chloridazon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.2±52.0 °C at 760 mmHg |
| Melting Point | 206ºC (tech., 198-202ºC) |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.643 |
| Flash Point | 142.6±30.7 °C |
| Exact Mass | 221.035583 |
| PSA | 60.91000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | WYKYKTKDBLFHCY-UHFFFAOYSA-N |
| SMILES | Nc1cnn(-c2ccccc2)c(=O)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R43;R50/53 |
| Safety Phrases | S24-S37-S60-S61 |
| RIDADR | 3077 |
| RTECS | UR6125000 |
| HS Code | 2933990017 |
|
~63%
Chloridazon CAS#:1698-60-8 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 50, # 2 p. 492 - 502 |
|
~%
Chloridazon CAS#:1698-60-8 |
| Literature: US4454318 A1, ; |
|
~%
Chloridazon CAS#:1698-60-8 |
| Literature: US4454318 A1, ; |
|
~%
Chloridazon CAS#:1698-60-8 |
| Literature: US4454318 A1, ; |
| HS Code | 2933990017 |
|---|---|
| Summary | 2933990017 6,7-dihydrodipyrido[1,2-a:2',1'-c]pyrazine-5,8-diium bromide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
Destruction of halogen-containing pesticides by means of detonation combustion.
Environ. Sci. Pollut. Res. Int. 20(2) , 855-61, (2013) Pesticides that contain a halogen functional group have been destructed by means of detonative combustion. The following compounds were examined: (1) atrazine-2-chloro-4-ethylamino-6-isopropylamino-1,... |
|
|
Prevention of chloridazon and metribuzin pollution using lignin-based formulations
Environ. Pollut. 158(5) , 1412-9, (2010) The herbicides chloridazon and metribuzin, identified as groundwater pollutants, were incorporated in lignin-based granules with different sizes to obtain controlled release formulations (CRFs) and re... |
|
|
Time- and dose-dependent induction of HSP70 in Lemna minor exposed to different environmental stressors.
Bull. Environ. Contam. Toxicol. 87(3) , 226-30, (2011) The objective of this study was to examine the influence of different stressors, including cadmium (heavy metal), anthracene (polycyclic aromatic hydrocarbon-PAH) and chloridazon (herbicide), on popul... |
| 5-Amino-4-chlor-2-phenylpyridazin-3(2H)-on |
| Chloridazon |
| pyrazon |
| 3(2H)-Pyridazinone, 5-amino-4-chloro-2-phenyl- |
| MFCD00055402 |
| PYRAMIN |
| 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one |
| 5-Amino-4-chloro-2-phenyl-2H-pyridazin-3-one |
| PAC |
| EINECS 216-920-2 |
| 5-Amino-4-chloro-2-phenyl-3(2H)-pyridazinone |
| Chloridazon,Pyrazone |
| Poly (acrylic acid-co-hypophosphite) sodium salt |