odoratone structure
|
Common Name | odoratone | ||
|---|---|---|---|---|
| CAS Number | 16962-90-6 | Molecular Weight | 472.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 571.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5±23.6 °C | |
Use of odoratoneOdoratone (Dehydroodoratol) has insecticidal activity (LC50: 154 ppm)[1]. |
| Name | (5R,9R,10R,13S,14S,17S)-17-((R)-1-((2R,3R,4S)-3,4-dihydroxy-5,5-dimethyltetrahydrofuran-2-yl)ethyl)-4,4,10,13,14-pentamethyl-1,2,4,5,6,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Odoratone (Dehydroodoratol) has insecticidal activity (LC50: 154 ppm)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 571.2±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.700 |
| Flash Point | 177.5±23.6 °C |
| Exact Mass | 472.355255 |
| PSA | 66.76000 |
| LogP | 6.95 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | QVEUBDDZMCFHNJ-UHFFFAOYSA-N |
| SMILES | CC(C1OC(C)(C)C(O)C1O)C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3CCC12C |
| Hazard Codes | Xi |
|---|
| (5R,9R,10R,13S,14S,17S)-17-{(1R)-1-[(2R,3R,4S)-3,4-Dihydroxy-5,5-dimethyltetrahydro-2-furanyl]ethyl}-4,4,10,13,14-pentamethyl-1,2,4,5,6,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one |