Erastin2
Modify Date: 2025-08-25 18:30:49
Erastin2 structure
|
Common Name | Erastin2 | ||
|---|---|---|---|---|
| CAS Number | 1695533-44-8 | Molecular Weight | 623.141 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 807.0±75.0 °C at 760 mmHg | |
| Molecular Formula | C36H35ClN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 441.8±37.1 °C | |
Use of Erastin2Erastin2 is a ferroptosis inducer and a potent, selective inhibitor of the system xc(-) cystine/glutamate transporter[1][2]. |
| Name | Erastin2 |
|---|---|
| Synonym | More Synonyms |
| Description | Erastin2 is a ferroptosis inducer and a potent, selective inhibitor of the system xc(-) cystine/glutamate transporter[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 807.0±75.0 °C at 760 mmHg |
| Molecular Formula | C36H35ClN4O4 |
| Molecular Weight | 623.141 |
| Flash Point | 441.8±37.1 °C |
| Exact Mass | 622.234680 |
| LogP | 6.40 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | WLPHOTYCGOGILE-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(-c2ccccc2)cc1-n1c(CN2CCN(C(=O)COc3ccc(Cl)cc3)CC2)nc2ccccc2c1=O |
| Erastin2 |
| 4(3H)-Quinazolinone, 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[4-(1-methylethoxy)[1,1'-biphenyl]-3-yl]- |
| 2-({4-[(4-Chlorophenoxy)acetyl]-1-piperazinyl}methyl)-3-(4-isopropoxy-3-biphenylyl)-4(3H)-quinazolinone |