Apcin-A structure
|
Common Name | Apcin-A | ||
|---|---|---|---|---|
| CAS Number | 1683617-62-0 | Molecular Weight | 342.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14Cl3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Apcin-AApcin-A, an Apcin derivative, is an anaphase-promoting complex (APC) inhibitor. Apcin-A interacts strongly with Cdc20, and inhibits the ubiquitination of Cdc20 substrates. Apcin-A can be used to synthesize the PROTAC CP5V (HY-130257)[1]. |
| Name | Apcin-A |
|---|
| Description | Apcin-A, an Apcin derivative, is an anaphase-promoting complex (APC) inhibitor. Apcin-A interacts strongly with Cdc20, and inhibits the ubiquitination of Cdc20 substrates. Apcin-A can be used to synthesize the PROTAC CP5V (HY-130257)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H14Cl3N5O2 |
|---|---|
| Molecular Weight | 342.61 |
| InChIKey | JQTSJVDIFMKETH-UHFFFAOYSA-N |
| SMILES | NCCCOC(=O)NC(Nc1ncccn1)C(Cl)(Cl)Cl |
| Hazard Codes | Xi |
|---|