Hemiphroside B structure
|
Common Name | Hemiphroside B | ||
|---|---|---|---|---|
| CAS Number | 165338-28-3 | Molecular Weight | 682.62 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 943.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C31H38O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.3±27.8 °C | |
Use of Hemiphroside BHemiphroside B is found in Lagotis integra[1]. |
| Name | Hemiphroside B |
|---|---|
| Synonym | More Synonyms |
| Description | Hemiphroside B is found in Lagotis integra[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 943.9±65.0 °C at 760 mmHg |
| Molecular Formula | C31H38O17 |
| Molecular Weight | 682.62 |
| Flash Point | 300.3±27.8 °C |
| Exact Mass | 682.210876 |
| PSA | 271.59000 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | MMSLLYRTBSZHLL-NQPXJSJASA-N |
| SMILES | CC(=O)OCC1OC(OC2C(O)C(OCCc3ccc(O)c(O)c3)OC(CO)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-O-acetyl-β-D-glucopyranosyl)-4-O-[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]- |
| 2-(3,4-Dihydroxyphenyl)ethyl 3-O-(6-O-acetyl-β-D-glucopyranosyl)-4-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-β-D-glucopyranoside |