4-Methyl-5-nitro-1H-indol structure
|
Common Name | 4-Methyl-5-nitro-1H-indol | ||
|---|---|---|---|---|
| CAS Number | 165250-69-1 | Molecular Weight | 176.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 359.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5±22.3 °C | |
| Name | 4-Methyl-5-nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.9±22.0 °C at 760 mmHg |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.172 |
| Flash Point | 171.5±22.3 °C |
| Exact Mass | 176.058578 |
| PSA | 61.61000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | XRJNLFAXLSBIDS-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])ccc2[nH]ccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~79%
4-Methyl-5-nitr... CAS#:165250-69-1 |
| Literature: Synaptic Pharmaceutical Corporation Patent: US5677321 A1, 1997 ; US 5677321 A |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-5-nitro-1H-indole |
| 1H-Indole, 4-methyl-5-nitro- |
| 4-Methyl-5-nitro-1H-indol |