1-[4-(5-Nitro-1H-indol-3-yl)-1-piperidinyl]ethanone structure
|
Common Name | 1-[4-(5-Nitro-1H-indol-3-yl)-1-piperidinyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 111608-65-2 | Molecular Weight | 287.31400 | |
| Density | 1.322 | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-(5-nitro-1H-indol-3-yl)piperidin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322 |
|---|---|
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.31400 |
| Exact Mass | 287.12700 |
| PSA | 81.92000 |
| LogP | 3.26310 |
| InChIKey | XWAIZWOYWKCWCQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(c2c[nH]c3ccc([N+](=O)[O-])cc23)CC1 |
|
~47%
1-[4-(5-Nitro-1... CAS#:111608-65-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 41, # 9 p. 1589 - 1595 |
|
~%
1-[4-(5-Nitro-1... CAS#:111608-65-2 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 41, # 9 p. 1589 - 1595 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-<4-(5-nitro-1H-indol-3-yl)piperidino>ethanone |
| 1-[4-(5-NITRO-1H-INDOL-3-YL)-1-PIPERIDINYL]ETHANONE |
| 3-(1-acetyl-4-piperidyl)-5-nitroindole |