2-(2-fluorophenyl)quinoline-4-carboxylic acid
Modify Date: 2024-01-10 18:17:09
2-(2-fluorophenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(2-fluorophenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1647-89-8 | Molecular Weight | 267.25500 | |
| Density | N/A | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C16H10FNO2 | Melting Point | 230ºC | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | 2-(2-fluorophenyl)quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 448.5ºC at 760 mmHg |
|---|---|
| Melting Point | 230ºC |
| Molecular Formula | C16H10FNO2 |
| Molecular Weight | 267.25500 |
| Flash Point | 225.1ºC |
| Exact Mass | 267.07000 |
| PSA | 50.19000 |
| LogP | 3.73910 |
| Vapour Pressure | 7.86E-09mmHg at 25°C |
| InChIKey | DKOMWOZFQXNJAQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2F)nc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
|
~86%
2-(2-fluorophen... CAS#:1647-89-8 |
| Literature: Nicolaie, E; Guengoer, T; Goyard, J; Cure, G; Fouquet, A; et al. European Journal of Medicinal Chemistry, 1992 , vol. 27, # 9 p. 977 - 984 |
|
~70%
2-(2-fluorophen... CAS#:1647-89-8 |
| Literature: Aboul-Enein, Hassan Y.; Ibrahim, Said E. Journal of Fluorine Chemistry, 1992 , vol. 59, # 2 p. 233 - 237 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-fluoro-phenyl)-quinoline-4-carboxylic acid |
| 2-(2-Fluorphenyl)-chinolin-4-carbonsaeure |
| fluorophenylquinolinecarboxylicacid |