Benzamide,N-ethyl-N-phenyl- structure
|
Common Name | Benzamide,N-ethyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 16466-44-7 | Molecular Weight | 225.28600 | |
| Density | 1.107g/cm3 | Boiling Point | 355.3ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | N-ethyl-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 355.3ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 159.7ºC |
| Exact Mass | 225.11500 |
| PSA | 20.31000 |
| LogP | 3.35330 |
| Vapour Pressure | 3.16E-05mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | VSURRQZMKWVYIC-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-ethylphenyl-N-benzamide |
| N-ethylbenzanilide |
| N-phenyl benzanilide |
| Benzoesaeure-aethylanilid |
| N-ethyl-N-phenyl-benzamide |
| Benzamide,N-ethyl-N-phenyl |
| N-Aethyl-benzanilid |