Tetramethylfluoroformamidinium hexafluorophosphate structure
|
Common Name | Tetramethylfluoroformamidinium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 164298-23-1 | Molecular Weight | 264.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12F7N2P | Melting Point | 104-109 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Tetramethylfluoroformamidinium hexafluorophosphateTetramethylfluoroformamidinium (hexafluorophosphate) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Description | Tetramethylfluoroformamidinium (hexafluorophosphate) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 104-109 °C(lit.) |
|---|---|
| Molecular Formula | C5H12F7N2P |
| Molecular Weight | 264.12 |
| Exact Mass | 264.06300 |
| PSA | 19.84000 |
| LogP | 3.52800 |
| InChIKey | ZAVXOOLKAGPJPI-UHFFFAOYSA-N |
| SMILES | CN(C)C(F)=[N+](C)C.F[P-](F)(F)(F)(F)F |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (Dimethylamino)(fluoro)-N,N-dimethylmethaniminium hexafluorophosphate |
| N-[(Dimethylamino)(fluoro)methylene]-N-methylmethanaminium hexafluorophosphate |
| Fluoro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate |
| N-((Dimethylamino)fluoromethylene)-N-methylmethanaminium hexafluorophosphate(V) |
| TFFH |
| Fluoro-N,N,N‘,N‘-tetramethylformamidinium hexafluorophosphate |
| Fluoro-N,N,N',N'-tetramethylformamidinium Hexafluorophosphate |
| Fluoro-N,N,N‘,N’etramethylformamidinium hexafluorophosphate |
| [dimethylamino(fluoro)methylidene]-dimethylazanium,hexafluorophosphate |
| N,N,N',N'-Tetramethylfluoroformamidinium hexafluorophosphate |
| MFCD02684443 |
| Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophos |