3,5-dimethyl-1h-indole-2-carboxylic acid structure
|
Common Name | 3,5-dimethyl-1h-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 16381-45-6 | Molecular Weight | 189.21100 | |
| Density | 1.287g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | 3,5-dimethyl-1h-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Flash Point | 203.7ºC |
| Exact Mass | 189.07900 |
| PSA | 53.09000 |
| LogP | 2.48290 |
| Vapour Pressure | 1.44E-07mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | GBZZEXCOEXFISD-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(C(=O)O)c(C)c2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-dimethylindole-2-carboxylic acid |