Auristatin F structure
|
Common Name | Auristatin F | ||
|---|---|---|---|---|
| CAS Number | 163768-50-1 | Molecular Weight | 745.989 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 894.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C40H67N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 494.7±34.3 °C | |
Use of Auristatin FAuristatin F is a cytotoxic tubulin modifier with potent and selective antitumor activity; MMAF analog and cytotoxin in Antibody-drug conjugates. |
| Name | auristatin F |
|---|---|
| Synonym | More Synonyms |
| Description | Auristatin F is a cytotoxic tubulin modifier with potent and selective antitumor activity; MMAF analog and cytotoxin in Antibody-drug conjugates. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 894.4±65.0 °C at 760 mmHg |
| Molecular Formula | C40H67N5O8 |
| Molecular Weight | 745.989 |
| Flash Point | 494.7±34.3 °C |
| Exact Mass | 745.498962 |
| PSA | 157.82000 |
| LogP | 4.99 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | LGNCNVVZCUVPOT-FUVGGWJZSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(Cc1ccccc1)C(=O)O)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C)C(C)C |
| Storage condition | 2-8℃ |
| Auristatin F |
| N,N-Dimethyl-L-valyl-N-[(3R,4S,5S)-1-{(2S)-2-[(1R,2R)-3-{[(1S)-1-carboxy-2-phenylethyl]amino}-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl}-3-methoxy-5-methyl-1-oxo-4-heptanyl]-N-methyl-L-valinamide |
| L-Valinamide, N,N-dimethyl-L-valyl-N-[(1S,2R)-4-[(2S)-2-[(1R,2R)-3-[[(1S)-1-carboxy-2-phenylethyl]amino]-1-methoxy-2-methyl-3-oxopropyl]-1-pyrrolidinyl]-2-methoxy-1-[(1S)-1-methylpropyl]-4-oxobutyl]-N-methyl- |