BOC-3,5-DIIODO-TYR-OSU structure
|
Common Name | BOC-3,5-DIIODO-TYR-OSU | ||
|---|---|---|---|---|
| CAS Number | 163679-35-4 | Molecular Weight | 630.17000 | |
| Density | 1.97g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H20I2N2O7 | Melting Point | 144-148ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of BOC-3,5-DIIODO-TYR-OSUBoc-Tyr(3,5-I2)-OSu is a tyrosine derivative[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-(4-hydroxy-3,5-diiodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Tyr(3,5-I2)-OSu is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.97g/cm3 |
|---|---|
| Melting Point | 144-148ºC |
| Molecular Formula | C18H20I2N2O7 |
| Molecular Weight | 630.17000 |
| Exact Mass | 629.93600 |
| PSA | 122.24000 |
| LogP | 2.97320 |
| Index of Refraction | 1.671 |
| InChIKey | OOTFAHIVGAQXOL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(I)c(O)c(I)c1)C(=O)ON1C(=O)CCC1=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (S)-2-tert-butoxycarbonylamino-3-(4-hydroxy-3,5-diiodophenyl)propionic acid 2,5-dioxopyrrolidin-1-yl ester |
| Boc-3,5-diiodo-L-tyrosine hydroxysuccinimide ester |
| Boc-Tyr(3,5-I2)-OSu |