dimethenamid-P structure
|
Common Name | dimethenamid-P | ||
|---|---|---|---|---|
| CAS Number | 163515-14-8 | Molecular Weight | 275.795 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H18ClNO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 185.4±27.9 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | (S)-dimethenamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.9±42.0 °C at 760 mmHg |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.795 |
| Flash Point | 185.4±27.9 °C |
| Exact Mass | 275.074677 |
| PSA | 57.78000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | JLYFCTQDENRSOL-VIFPVBQESA-N |
| SMILES | COCC(C)N(C(=O)CCl)c1c(C)csc1C |
| Storage condition | 2-8°C |
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H331-H334 |
| Precautionary Statements | P261-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/22 |
| Safety Phrases | 23-36/37-45 |
| RIDADR | NONH for all modes of transport |
| RTECS | AB5444600 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| 2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-[(1S)-2-methoxy-1-methylethyl]acetamide |
| 2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxy-2-propanyl]acetamide |
| 8319839 |
| dimethenamid-P |
| 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| T5SJ B1 CNV1GY1&1O1 D1 &&S Form |
| Dimethenamide-P |
| UNII-9H95J2H62E |
| (S)-2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-(2-methoxy-1-methylethyl)acetamide |
| Acetamide, 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-[(1S)-2-methoxy-1-methylethyl]- |
| 2-Chlor-N-(2,4-dimethyl-3-thienyl)-N-[(2S)-1-methoxypropan-2-yl]acetamid |