SBC-110736
Modify Date: 2025-08-27 10:47:44
SBC-110736 structure
|
Common Name | SBC-110736 | ||
|---|---|---|---|---|
| CAS Number | 1629166-02-4 | Molecular Weight | 413.512 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 681.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.7±31.5 °C | |
Use of SBC-110736SBC-110736 is a proprotein convertase subtilisin kexin type 9 (PCSK9) inhibitor extracted from patent WO2014150395A1, Figure 1. |
| Name | N-(4-{[4-(4-Methylphenyl)-2-phenyl-1-piperazinyl]carbonyl}phenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | SBC-110736 is a proprotein convertase subtilisin kexin type 9 (PCSK9) inhibitor extracted from patent WO2014150395A1, Figure 1. |
|---|---|
| Related Catalog | |
| References |
[1]. WO2014150395A1 |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 681.1±55.0 °C at 760 mmHg |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.512 |
| Flash Point | 365.7±31.5 °C |
| Exact Mass | 413.210327 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | PILMFSWQYWYOJC-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)N2CCN(c3ccc(C)cc3)CC2c2ccccc2)cc1 |
| Storage condition | 2-8℃ |
| N-(4-{[4-(4-Methylphenyl)-2-phenyl-1-piperazinyl]carbonyl}phenyl)acetamide |
| Acetamide, N-[4-[[4-(4-methylphenyl)-2-phenyl-1-piperazinyl]carbonyl]phenyl]- |
| SBC-110736 |