Carboxy-PEG4-phosphonic acid
Modify Date: 2025-08-26 23:49:13
Carboxy-PEG4-phosphonic acid structure
|
Common Name | Carboxy-PEG4-phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 1623791-69-4 | Molecular Weight | 330.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H23O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Carboxy-PEG4-phosphonic acidCarboxy-PEG4-phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Carboxy-PEG4-phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Carboxy-PEG4-phosphonic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C11H23O9P |
|---|---|
| Molecular Weight | 330.27 |
| InChIKey | HQKHMGCGBQVUTI-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCP(=O)(O)O |
| MFCD30182021 |