Heptafluoropropyl trifluorovinyl ether structure
|
Common Name | Heptafluoropropyl trifluorovinyl ether | ||
|---|---|---|---|---|
| CAS Number | 1623-05-8 | Molecular Weight | 266.03700 | |
| Density | 1,53 g/cm3 | Boiling Point | 35 °C | |
| Molecular Formula | C5F10O | Melting Point | -70 °C | |
| MSDS | N/A | Flash Point | -20°C | |
| Name | Heptafluoropropyl trifluorovinyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1,53 g/cm3 |
|---|---|
| Boiling Point | 35 °C |
| Melting Point | -70 °C |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.03700 |
| Flash Point | -20°C |
| Exact Mass | 265.97900 |
| PSA | 9.23000 |
| LogP | 3.82850 |
| Vapour Pressure | 289mmHg at 25°C |
| Index of Refraction | 1.272 |
| InChIKey | KHXKESCWFMPTFT-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | S9-S16-S33 |
| RIDADR | 3271 |
| HS Code | 2909199090 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00236685 |
| 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2-trifluoroethenoxy)propane |
| EINECS 216-600-2 |
| Perfluoro(propyl Vinyl Ether) |
| Perfluoropropoxyethylene |